C13H20N4O7 — CID 90220427
2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]morpholine-4-carboxylic acid (PubChem CID 90220427) has the molecular formula C13H20N4O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]morpholine-4-carboxylic acid.
| Compound Name | 2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 90220427 |
| Molecular Formula | C13H20N4O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]morpholine-4-carboxylic acid |
| SMILES | O=C(NOCC1CN(C(=O)O)CCO1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C13H20N4O7/c18-11(10-2-1-8-5-16(10)12(19)17(8)22)14-24-7-9-6-15(13(20)21)3-4-23-9/h8-10,22H,1-7H2,(H,14,18)(H,20,21)/t8-,9?,10+/m1/s1 |
| InChIKey | YJLOWBLSUDAYNH-FIBVVXLUSA-N |
| XLogP | -0.93 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|