C10H12N4O4 — CID 86701379
3-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 86701379) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 3-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 86701379 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1cc([C@@H]2CC[C@@H]3CN2C(=O)N3O)no1 |
| InChI | InChI=1S/C10H12N4O4/c11-9(15)8-3-6(12-18-8)7-2-1-5-4-13(7)10(16)14(5)17/h3,5,7,17H,1-2,4H2,(H2,11,15)/t5-,7+/m1/s1 |
| InChIKey | NYORARMVWZIVPR-VDTYLAMSSA-N |
| XLogP | 0.10 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|