C11H16N4O2 — CID 87753410
3-[1-(2-iminoethyl)piperidin-4-yl]-1,2-oxazole-5-carboxamide (PubChem CID 87753410) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[1-(2-iminoethyl)piperidin-4-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[1-(2-iminoethyl)piperidin-4-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 87753410 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-[1-(2-iminoethyl)piperidin-4-yl]-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C/CN1CCC(c2cc(C(N)=O)on2)CC1 |
| InChI | InChI=1S/C11H16N4O2/c12-3-6-15-4-1-8(2-5-15)9-7-10(11(13)16)17-14-9/h3,7-8,12H,1-2,4-6H2,(H2,13,16)/b12-3+ |
| InChIKey | QLVLFMWSMOFQSU-KGVSQERTSA-N |
| XLogP | 0.60 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|