C16H19N4O2+ — CID 157242106
(2S,5R)-6-methyl-2-[5-(1-methylpyridin-1-ium-4-yl)-1,2-oxazol-3-yl]-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 157242106) has the molecular formula C16H19N4O2+ and a molecular weight of 299.35 g/mol. Its IUPAC name is (2S,5R)-6-methyl-2-[5-(1-methylpyridin-1-ium-4-yl)-1,2-oxazol-3-yl]-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-6-methyl-2-[5-(1-methylpyridin-1-ium-4-yl)-1,2-oxazol-3-yl]-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 157242106 |
| Molecular Formula | C16H19N4O2+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2S,5R)-6-methyl-2-[5-(1-methylpyridin-1-ium-4-yl)-1,2-oxazol-3-yl]-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | CN1C(=O)N2C[C@H]1CC[C@H]2c1cc(-c2cc[n+](C)cc2)on1 |
| InChI | InChI=1S/C16H19N4O2/c1-18-7-5-11(6-8-18)15-9-13(17-22-15)14-4-3-12-10-20(14)16(21)19(12)2/h5-9,12,14H,3-4,10H2,1-2H3/q+1/t12-,14+/m1/s1 |
| InChIKey | VGENPOBZOIIWLR-OCCSQVGLSA-N |
| XLogP | 1.74 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|