C13H19N5O2S — CID 160772706
(2S,5R)-6-hydroxy-2-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 160772706) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-2-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-6-hydroxy-2-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 160772706 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2S,5R)-6-hydroxy-2-(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(O)[C@@H]2CC[C@@H](c3nnc(N4CCCCC4)s3)N1C2 |
| InChI | InChI=1S/C13H19N5O2S/c19-13-17-8-9(18(13)20)4-5-10(17)11-14-15-12(21-11)16-6-2-1-3-7-16/h9-10,20H,1-8H2/t9-,10+/m1/s1 |
| InChIKey | QTAVYOTXYBWMRC-ZJUUUORDSA-N |
| XLogP | 1.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|