C12H20N4S — CID 82481560
2-piperidin-1-yl-5-piperidin-3-yl-1,3,4-thiadiazole (PubChem CID 82481560) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 2-piperidin-1-yl-5-piperidin-3-yl-1,3,4-thiadiazole.
| Compound Name | 2-piperidin-1-yl-5-piperidin-3-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 82481560 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-piperidin-1-yl-5-piperidin-3-yl-1,3,4-thiadiazole |
| SMILES | C1CCN(c2nnc(C3CCCNC3)s2)CC1 |
| InChI | InChI=1S/C12H20N4S/c1-2-7-16(8-3-1)12-15-14-11(17-12)10-5-4-6-13-9-10/h10,13H,1-9H2 |
| InChIKey | WLALDBZEPKLRRM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |