2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid

C9H12N2O2S — CID 105466008

IUPAC2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCCNC2)s1
InChIInChI=1S/C9H12N2O2S/c12-9(13)7-5-11-8(14-7)6-2-1-3-10-4-6/h5-6,10H,1-4H2,(H,12,13)
InChIKeyMWLHEJCKJHCEKC-UHFFFAOYSA-N
MW212.27 g/mol
LogP1.31
Rot. Bonds2

About 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid

2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 105466008) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid
PubChem CID105466008
Molecular FormulaC9H12N2O2S
Molecular Weight212.27 g/mol
Exact Mass212.06
IUPAC Name2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCCNC2)s1
InChIInChI=1S/C9H12N2O2S/c12-9(13)7-5-11-8(14-7)6-2-1-3-10-4-6/h5-6,10H,1-4H2,(H,12,13)
InChIKeyMWLHEJCKJHCEKC-UHFFFAOYSA-N
XLogP1.31
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.27
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid (CID 105466008) is 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(C2CCCNC2)s1.
What is the InChIKey of 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is MWLHEJCKJHCEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c12-9(13)7-5-11-8(14-7)6-2-1-3-10-4-6/h5-6,10H,1-4H2,(H,12,13).
What are the key properties of 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid?
2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 105466008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).