C8H10N2OS — CID 115089760
2-pyrrolidin-3-yl-1,3-thiazole-5-carbaldehyde (PubChem CID 115089760) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-pyrrolidin-3-yl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 115089760 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-pyrrolidin-3-yl-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CCNC2)s1 |
| InChI | InChI=1S/C8H10N2OS/c11-5-7-4-10-8(12-7)6-1-2-9-3-6/h4-6,9H,1-3H2 |
| InChIKey | DLJXBUQACAOQAM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|