C8H9NO2S — CID 92669690
2-[(2S)-oxolan-2-yl]-1,3-thiazole-5-carbaldehyde (PubChem CID 92669690) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-[(2S)-oxolan-2-yl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[(2S)-oxolan-2-yl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 92669690 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 2-[(2S)-oxolan-2-yl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc([C@@H]2CCCO2)s1 |
| InChI | InChI=1S/C8H9NO2S/c10-5-6-4-9-8(12-6)7-2-1-3-11-7/h4-5,7H,1-3H2/t7-/m0/s1 |
| InChIKey | SQICHXMMJHXHHR-ZETCQYMHSA-N |
| XLogP | 1.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|