C13H11NO2S — CID 65404990
2-(3,4-dihydro-2H-chromen-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 65404990) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 65404990 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CCOc3ccccc32)s1 |
| InChI | InChI=1S/C13H11NO2S/c15-8-9-7-14-13(17-9)11-5-6-16-12-4-2-1-3-10(11)12/h1-4,7-8,11H,5-6H2 |
| InChIKey | BIPLQOJOJFIADK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|