C11H22N4O4 — CID 15719926
tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 15719926) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15719926 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)NNCCC(N)=O |
| InChI | InChI=1S/C11H22N4O4/c1-7(14-10(18)19-11(2,3)4)9(17)15-13-6-5-8(12)16/h7,13H,5-6H2,1-4H3,(H2,12,16)(H,14,18)(H,15,17)/t7-/m0/s1 |
| InChIKey | XAVVONOEBHOKJV-ZETCQYMHSA-N |
| XLogP | -0.60 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|