C16H28N4O4 — CID 162739079
tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]carbamate (PubChem CID 162739079) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 162739079 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC12CC(C1)C2)C(=O)NNCCC(N)=O |
| InChI | InChI=1S/C16H28N4O4/c1-15(2,3)24-14(23)19-11(9-16-6-10(7-16)8-16)13(22)20-18-5-4-12(17)21/h10-11,18H,4-9H2,1-3H3,(H2,17,21)(H,19,23)(H,20,22)/t10?,11-,16?/m0/s1 |
| InChIKey | FHDSEDADPQRFRY-CSJGVYOVSA-N |
| XLogP | 0.57 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|