C41H28O — CID 157199976
1-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,2,3,5,6,7,8-heptadeuterio-9,9-dimethylfluoren-4-yl)anthracen-9-yl]dibenzofuran (PubChem CID 157199976) has the molecular formula C41H28O and a molecular weight of 551.77 g/mol. Its IUPAC name is 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,2,3,5,6,7,8-heptadeuterio-9,9-dimethylfluoren-4-yl)anthracen-9-yl]dibenzofuran.
| Compound Name | 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,2,3,5,6,7,8-heptadeuterio-9,9-dimethylfluoren-4-yl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 157199976 |
| Molecular Formula | C41H28O |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 1-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,2,3,5,6,7,8-heptadeuterio-9,9-dimethylfluoren-4-yl)anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cccc5oc6ccccc6c45)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c([2H])c1C2(C)C |
| InChI | InChI=1S/C41H28O/c1-41(2)33-21-9-7-17-29(33)39-31(19-11-22-34(39)41)37-25-13-3-5-15-27(25)38(28-16-6-4-14-26(28)37)32-20-12-24-36-40(32)30-18-8-10-23-35(30)42-36/h3-24H,1-2H3/i3D,4D,5D,6D,7D,9D,11D,13D,14D,15D,16D,17D,19D,21D,22D |
| InChIKey | KXUPKXQKMDLFCV-SNTFUGTLSA-N |
| XLogP | 11.53 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|