C8H8F3NO — CID 157200438
1-[5-(2,2,2-trifluoroethyl)-2H-pyrrol-3-yl]ethanone (PubChem CID 157200438) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is 1-[5-(2,2,2-trifluoroethyl)-2H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-(2,2,2-trifluoroethyl)-2H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 157200438 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1-[5-(2,2,2-trifluoroethyl)-2H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)C1=CC(CC(F)(F)F)=NC1 |
| InChI | InChI=1S/C8H8F3NO/c1-5(13)6-2-7(12-4-6)3-8(9,10)11/h2H,3-4H2,1H3 |
| InChIKey | KXUXLXGNMIZGKW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |