C29H34N4O5 — CID 157201220
(3R)-N-tert-butyl-3-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-N'-[(2S)-3-oxo-4-phenylbutan-2-yl]pentanediamide (PubChem CID 157201220) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is (3R)-N-tert-butyl-3-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-N'-[(2S)-3-oxo-4-phenylbutan-2-yl]pentanediamide.
| Compound Name | (3R)-N-tert-butyl-3-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-N'-[(2S)-3-oxo-4-phenylbutan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 157201220 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (3R)-N-tert-butyl-3-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-N'-[(2S)-3-oxo-4-phenylbutan-2-yl]pentanediamide |
| SMILES | C[C@H](NC(=O)C[C@H](CC(=O)NC(C)(C)C)NC(=O)C(=O)c1c[nH]c2ccccc12)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H34N4O5/c1-18(24(34)14-19-10-6-5-7-11-19)31-25(35)15-20(16-26(36)33-29(2,3)4)32-28(38)27(37)22-17-30-23-13-9-8-12-21(22)23/h5-13,17-18,20,30H,14-16H2,1-4H3,(H,31,35)(H,32,38)(H,33,36)/t18-,20+/m0/s1 |
| InChIKey | OPKMXEFUQKPZSU-AZUAARDMSA-N |
| XLogP | 2.85 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|