About 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol
1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol (PubChem CID 157201478) has the molecular formula C24H30O3
and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol.
Molecular Properties
| Compound Name | 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol |
| PubChem CID | 157201478 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol |
| SMILES | C=Cc1ccc(O)cc1.C=Cc1ccc(OCCOC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22O2.C8H8O/c1-2-14-8-10-16(11-9-14)18-13-12-17-15-6-4-3-5-7-15;1-2-7-3-5-8(9)6-4-7/h2,8-11,15H,1,3-7,12-13H2;2-6,9H,1H2 |
| InChIKey | AQVQDMQQYNMNPV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol?
The IUPAC name of 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol (CID 157201478) is 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol.
What is the SMILES notation for 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol?
The canonical SMILES for 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol is C=Cc1ccc(O)cc1.C=Cc1ccc(OCCOC2CCCCC2)cc1.
What is the InChIKey of 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol?
The InChIKey is AQVQDMQQYNMNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2.C8H8O/c1-2-14-8-10-16(11-9-14)18-13-12-17-15-6-4-3-5-7-15;1-2-7-3-5-8(9)6-4-7/h2,8-11,15H,1,3-7,12-13H2;2-6,9H,1H2.
What are the key properties of 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol?
1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol has a molecular weight of 366.50 g/mol, XLogP of 6.09, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexyloxyethoxy)-4-ethenylbenzene;4-ethenylphenol is sourced from PubChem (CID 157201478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).