C31H37NO2 — CID 157201699
(2R,5S,6R,14R,16R)-N,6-dimethyl-5-naphthalen-2-yl-N-(trideuteriomethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide (PubChem CID 157201699) has the molecular formula C31H37NO2 and a molecular weight of 458.66 g/mol. Its IUPAC name is (2R,5S,6R,14R,16R)-N,6-dimethyl-5-naphthalen-2-yl-N-(trideuteriomethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide.
| Compound Name | (2R,5S,6R,14R,16R)-N,6-dimethyl-5-naphthalen-2-yl-N-(trideuteriomethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide |
|---|---|
| PubChem CID | 157201699 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (2R,5S,6R,14R,16R)-N,6-dimethyl-5-naphthalen-2-yl-N-(trideuteriomethyl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide |
| SMILES | [2H]C([2H])([2H])[N+](C)([O-])[C@@H]1CCC2=CC3=CC[C@]4(C)[C@@H](c5ccc6ccccc6c5)CC[C@H]4C34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C31H37NO2/c1-29-15-14-25-19-24-10-11-26(32(2,3)33)20-30(24)16-17-31(25,34-30)28(29)13-12-27(29)23-9-8-21-6-4-5-7-22(21)18-23/h4-9,14,18-19,26-28H,10-13,15-17,20H2,1-3H3/t26-,27-,28-,29-,30-,31?/m1/s1/i2D3/t26-,27-,28-,29-,30-,31?,32? |
| InChIKey | XMTYNZWSIOTIDM-KSBCNNNESA-N |
| XLogP | 7.02 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|