C34H43NO2 — CID 126502086
(1S,2R,5S,6R,14R,16R)-N-ethyl-6-methyl-5-naphthalen-2-yl-N-propan-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide (PubChem CID 126502086) has the molecular formula C34H43NO2 and a molecular weight of 497.72 g/mol. Its IUPAC name is (1S,2R,5S,6R,14R,16R)-N-ethyl-6-methyl-5-naphthalen-2-yl-N-propan-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide.
| Compound Name | (1S,2R,5S,6R,14R,16R)-N-ethyl-6-methyl-5-naphthalen-2-yl-N-propan-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide |
|---|---|
| PubChem CID | 126502086 |
| Molecular Formula | C34H43NO2 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | (1S,2R,5S,6R,14R,16R)-N-ethyl-6-methyl-5-naphthalen-2-yl-N-propan-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine oxide |
| SMILES | CC[N+]([O-])(C(C)C)[C@@H]1CCC2=CC3=CC[C@]4(C)[C@@H](c5ccc6ccccc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C34H43NO2/c1-5-35(36,23(2)3)29-13-12-27-21-28-16-17-32(4)30(26-11-10-24-8-6-7-9-25(24)20-26)14-15-31(32)34(28)19-18-33(27,22-29)37-34/h6-11,16,20-21,23,29-31H,5,12-15,17-19,22H2,1-4H3/t29-,30-,31-,32-,33-,34-,35?/m1/s1 |
| InChIKey | JGBFLFKRNFWYRM-USMMCZEHSA-N |
| XLogP | 8.19 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|