C52H62N6O4 — CID 157204723
tert-butyl N-[[4-(4-naphthalen-2-ylpyrimidin-2-yl)cyclohexyl]methyl]carbamate (PubChem CID 157204723) has the molecular formula C52H62N6O4 and a molecular weight of 835.11 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-naphthalen-2-ylpyrimidin-2-yl)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(4-naphthalen-2-ylpyrimidin-2-yl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 157204723 |
| Molecular Formula | C52H62N6O4 |
| Molecular Weight | 835.11 g/mol |
| Exact Mass | 834.48 |
| IUPAC Name | tert-butyl N-[[4-(4-naphthalen-2-ylpyrimidin-2-yl)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(c2nccc(-c3ccc4ccccc4c3)n2)CC1.CC(C)(C)OC(=O)NCC1CCC(c2nccc(-c3ccc4ccccc4c3)n2)CC1 |
| InChI | InChI=1S/2C26H31N3O2/c2*1-26(2,3)31-25(30)28-17-18-8-10-20(11-9-18)24-27-15-14-23(29-24)22-13-12-19-6-4-5-7-21(19)16-22/h2*4-7,12-16,18,20H,8-11,17H2,1-3H3,(H,28,30) |
| InChIKey | ARFIOBAFGSXELD-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.11 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |