C18H28N4O2 — CID 133300314
tert-butyl N-[[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 133300314) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 133300314 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl N-[[1-(2-cyclopropylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2ccnc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-18(2,3)24-17(23)20-12-13-7-10-22(11-8-13)15-6-9-19-16(21-15)14-4-5-14/h6,9,13-14H,4-5,7-8,10-12H2,1-3H3,(H,20,23) |
| InChIKey | KMEIHMZQRRTJQA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |