C22H22FN5O2 — CID 157207839
2-[5-(4-fluoro-1H-benzimidazol-2-yl)pentyl]-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 157207839) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[5-(4-fluoro-1H-benzimidazol-2-yl)pentyl]-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[5-(4-fluoro-1H-benzimidazol-2-yl)pentyl]-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 157207839 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[5-(4-fluoro-1H-benzimidazol-2-yl)pentyl]-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1coc(CCCCCc2nc3c(F)cccc3[nH]2)n1 |
| InChI | InChI=1S/C22H22FN5O2/c23-16-8-6-9-17-21(16)28-19(26-17)10-2-1-3-11-20-27-18(14-30-20)22(29)25-13-15-7-4-5-12-24-15/h4-9,12,14H,1-3,10-11,13H2,(H,25,29)(H,26,28) |
| InChIKey | ARNXMWCEFAAULB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|