C33H28N6O2 — CID 171770140
2-[2-[2-(3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-N-(benzo[f]quinolin-3-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 171770140) has the molecular formula C33H28N6O2 and a molecular weight of 540.63 g/mol. Its IUPAC name is 2-[2-[2-(3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-N-(benzo[f]quinolin-3-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[2-[2-(3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-N-(benzo[f]quinolin-3-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 171770140 |
| Molecular Formula | C33H28N6O2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[2-[2-(3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-N-(benzo[f]quinolin-3-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(ccc3ccccc32)n1)c1coc(CCNCCc2nc3c(ccc4ccccc43)[nH]2)n1 |
| InChI | InChI=1S/C33H28N6O2/c40-33(35-19-23-11-12-26-24-7-3-1-5-21(24)9-13-27(26)36-23)29-20-41-31(38-29)16-18-34-17-15-30-37-28-14-10-22-6-2-4-8-25(22)32(28)39-30/h1-14,20,34H,15-19H2,(H,35,40)(H,37,39) |
| InChIKey | FKXVTWONWNVNED-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|