C32H34N6O2 — CID 166083875
N-[(3-methyl-2-pyridinyl)methyl]-2-[2-[2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-yl]ethylamino]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 166083875) has the molecular formula C32H34N6O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[(3-methyl-2-pyridinyl)methyl]-2-[2-[2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-yl]ethylamino]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3-methyl-2-pyridinyl)methyl]-2-[2-[2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-yl]ethylamino]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166083875 |
| Molecular Formula | C32H34N6O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N-[(3-methyl-2-pyridinyl)methyl]-2-[2-[2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-yl]ethylamino]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cccnc1CNC(=O)c1coc(CCNCCc2nc3ccc(-c4ccc5c(c4)CCCC5)cc3[nH]2)n1 |
| InChI | InChI=1S/C32H34N6O2/c1-21-5-4-14-34-28(21)19-35-32(39)29-20-40-31(38-29)13-16-33-15-12-30-36-26-11-10-25(18-27(26)37-30)24-9-8-22-6-2-3-7-23(22)17-24/h4-5,8-11,14,17-18,20,33H,2-3,6-7,12-13,15-16,19H2,1H3,(H,35,39)(H,36,37) |
| InChIKey | UCGSCIPKOKMQIR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|