C13H14Cl2N2O — CID 157209657
5-(3,4-dichloro-N-methylanilino)-6-methylidenepiperidin-2-one (PubChem CID 157209657) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 5-(3,4-dichloro-N-methylanilino)-6-methylidenepiperidin-2-one.
| Compound Name | 5-(3,4-dichloro-N-methylanilino)-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 157209657 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(3,4-dichloro-N-methylanilino)-6-methylidenepiperidin-2-one |
| SMILES | C=C1NC(=O)CCC1N(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2O/c1-8-12(5-6-13(18)16-8)17(2)9-3-4-10(14)11(15)7-9/h3-4,7,12H,1,5-6H2,2H3,(H,16,18) |
| InChIKey | OCXLIDVRXQMYTD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |