C37H41N — CID 15721081
N-benzhydryl-2,2-bis(2,3,4,5,6-pentamethylphenyl)ethenimine (PubChem CID 15721081) has the molecular formula C37H41N and a molecular weight of 499.74 g/mol. Its IUPAC name is N-benzhydryl-2,2-bis(2,3,4,5,6-pentamethylphenyl)ethenimine.
| Compound Name | N-benzhydryl-2,2-bis(2,3,4,5,6-pentamethylphenyl)ethenimine |
|---|---|
| PubChem CID | 15721081 |
| Molecular Formula | C37H41N |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | N-benzhydryl-2,2-bis(2,3,4,5,6-pentamethylphenyl)ethenimine |
| SMILES | Cc1c(C)c(C)c(C(=C=NC(c2ccccc2)c2ccccc2)c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C37H41N/c1-22-24(3)28(7)35(29(8)25(22)4)34(36-30(9)26(5)23(2)27(6)31(36)10)21-38-37(32-17-13-11-14-18-32)33-19-15-12-16-20-33/h11-20,37H,1-10H3 |
| InChIKey | LVJOPJBWCHITGY-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|