C34H50N6O6 — CID 157211225
acetyl acetate;1-[2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydroindol-1-yl]ethanone;(4-methylpiperazin-1-yl)-(4,5,6,7-tetrahydro-1H-indol-2-yl)methanone (PubChem CID 157211225) has the molecular formula C34H50N6O6 and a molecular weight of 638.81 g/mol. Its IUPAC name is acetyl acetate;1-[2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydroindol-1-yl]ethanone;(4-methylpiperazin-1-yl)-(4,5,6,7-tetrahydro-1H-indol-2-yl)methanone.
| Compound Name | acetyl acetate;1-[2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydroindol-1-yl]ethanone;(4-methylpiperazin-1-yl)-(4,5,6,7-tetrahydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 157211225 |
| Molecular Formula | C34H50N6O6 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | acetyl acetate;1-[2-(4-methylpiperazine-1-carbonyl)-4,5,6,7-tetrahydroindol-1-yl]ethanone;(4-methylpiperazin-1-yl)-(4,5,6,7-tetrahydro-1H-indol-2-yl)methanone |
| SMILES | CC(=O)OC(C)=O.CC(=O)n1c(C(=O)N2CCN(C)CC2)cc2c1CCCC2.CN1CCN(C(=O)c2cc3c([nH]2)CCCC3)CC1 |
| InChI | InChI=1S/C16H23N3O2.C14H21N3O.C4H6O3/c1-12(20)19-14-6-4-3-5-13(14)11-15(19)16(21)18-9-7-17(2)8-10-18;1-16-6-8-17(9-7-16)14(18)13-10-11-4-2-3-5-12(11)15-13;1-3(5)7-4(2)6/h11H,3-10H2,1-2H3;10,15H,2-9H2,1H3;1-2H3 |
| InChIKey | ARXHCFXUJNYIRM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|