C20H25N3O3 — CID 157211284
N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-pentyl-2H-pyrrole-5-carboxamide (PubChem CID 157211284) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-pentyl-2H-pyrrole-5-carboxamide.
| Compound Name | N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-pentyl-2H-pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 157211284 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-pentyl-2H-pyrrole-5-carboxamide |
| SMILES | CCCCCC1=CC(C(=O)N[C@@H]2COc3ccccc3N(C)C2=O)=NC1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-4-5-8-14-11-15(21-12-14)19(24)22-16-13-26-18-10-7-6-9-17(18)23(2)20(16)25/h6-7,9-11,16H,3-5,8,12-13H2,1-2H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | ARXLLRNNMUSXOS-MRXNPFEDSA-N |
| XLogP | 2.49 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|