C34H30F6N6O2 — CID 157212120
4-(1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;2-[2-methyl-1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-2,3-dihydro-1,3-benzoxazole (PubChem CID 157212120) has the molecular formula C34H30F6N6O2 and a molecular weight of 668.64 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;2-[2-methyl-1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-2,3-dihydro-1,3-benzoxazole.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;2-[2-methyl-1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 157212120 |
| Molecular Formula | C34H30F6N6O2 |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;2-[2-methyl-1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-2,3-dihydro-1,3-benzoxazole |
| SMILES | Cc1nc2cc(C3Nc4ccccc4O3)ccc2n1CCC(F)(F)F.Nc1cc(-c2nc3ccccc3o2)ccc1NCCC(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O.C16H14F3N3O/c1-11-22-14-10-12(17-23-13-4-2-3-5-16(13)25-17)6-7-15(14)24(11)9-8-18(19,20)21;17-16(18,19)7-8-21-12-6-5-10(9-11(12)20)15-22-13-3-1-2-4-14(13)23-15/h2-7,10,17,23H,8-9H2,1H3;1-6,9,21H,7-8,20H2 |
| InChIKey | ARZVLZQOKMIRET-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|