C19H36O4 — CID 15721340
1-(2,5-dimethoxyoxolan-2-yl)tridecan-1-one (PubChem CID 15721340) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is 1-(2,5-dimethoxyoxolan-2-yl)tridecan-1-one.
| Compound Name | 1-(2,5-dimethoxyoxolan-2-yl)tridecan-1-one |
|---|---|
| PubChem CID | 15721340 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 1-(2,5-dimethoxyoxolan-2-yl)tridecan-1-one |
| SMILES | CCCCCCCCCCCCC(=O)C1(OC)CCC(OC)O1 |
| InChI | InChI=1S/C19H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-17(20)19(22-3)16-15-18(21-2)23-19/h18H,4-16H2,1-3H3 |
| InChIKey | CTYHALBCGBRIAN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|