C11H20O4 — CID 15721336
1-(2,5-dimethoxyoxolan-2-yl)pentan-1-one (PubChem CID 15721336) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyoxolan-2-yl)pentan-1-one.
| Compound Name | 1-(2,5-dimethoxyoxolan-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 15721336 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-(2,5-dimethoxyoxolan-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1(OC)CCC(OC)O1 |
| InChI | InChI=1S/C11H20O4/c1-4-5-6-9(12)11(14-3)8-7-10(13-2)15-11/h10H,4-8H2,1-3H3 |
| InChIKey | IVWFVFNHHNIKOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |