C11H18O4 — CID 162400089
[(2S,5S)-5-(3-methylbutanoyl)oxolan-2-yl] acetate (PubChem CID 162400089) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is [(2S,5S)-5-(3-methylbutanoyl)oxolan-2-yl] acetate.
| Compound Name | [(2S,5S)-5-(3-methylbutanoyl)oxolan-2-yl] acetate |
|---|---|
| PubChem CID | 162400089 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(2S,5S)-5-(3-methylbutanoyl)oxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](C(=O)CC(C)C)O1 |
| InChI | InChI=1S/C11H18O4/c1-7(2)6-9(13)10-4-5-11(15-10)14-8(3)12/h7,10-11H,4-6H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | CDIPYBAXRZROMB-WDEREUQCSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |