C13H24O3 — CID 176555230
2-hexyl-5-(2-methylpropyl)-1,3-dioxolan-4-one (PubChem CID 176555230) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-hexyl-5-(2-methylpropyl)-1,3-dioxolan-4-one.
| Compound Name | 2-hexyl-5-(2-methylpropyl)-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 176555230 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-hexyl-5-(2-methylpropyl)-1,3-dioxolan-4-one |
| SMILES | CCCCCCC1OC(=O)C(CC(C)C)O1 |
| InChI | InChI=1S/C13H24O3/c1-4-5-6-7-8-12-15-11(9-10(2)3)13(14)16-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | MSSRXIBGIXQMJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|