C14H24O3 — CID 101336634
(2S,5S)-2-tert-butyl-5-(cyclohexylmethyl)-1,3-dioxolan-4-one (PubChem CID 101336634) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-(cyclohexylmethyl)-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-(cyclohexylmethyl)-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 101336634 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-(cyclohexylmethyl)-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@H](CC2CCCCC2)O1 |
| InChI | InChI=1S/C14H24O3/c1-14(2,3)13-16-11(12(15)17-13)9-10-7-5-4-6-8-10/h10-11,13H,4-9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | RIXMRGCEINZRCL-AAEUAGOBSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |