About 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate
2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate (PubChem CID 20729078) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate.
Molecular Properties
| Compound Name | 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate |
| PubChem CID | 20729078 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate |
| SMILES | COC(C)OCCOC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C13H24O4/c1-11(15-2)16-8-9-17-13(14)10-12-6-4-3-5-7-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | INGVFHDOALHVOC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate?
The IUPAC name of 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate (CID 20729078) is 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate.
What is the SMILES notation for 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate?
The canonical SMILES for 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate is COC(C)OCCOC(=O)CC1CCCCC1.
What is the InChIKey of 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate?
The InChIKey is INGVFHDOALHVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-11(15-2)16-8-9-17-13(14)10-12-6-4-3-5-7-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate?
2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate has a molecular weight of 244.33 g/mol, XLogP of 2.51, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxyethoxy)ethyl 2-cyclohexylacetate is sourced from PubChem (CID 20729078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).