About ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one
ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one (PubChem CID 91001820) has the molecular formula C17H34O4
and a molecular weight of 302.46 g/mol. Its IUPAC name is ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one.
Molecular Properties
| Compound Name | ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one |
| PubChem CID | 91001820 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one |
| SMILES | CC.CC(C)CC(=O)C1CCCO1.COC(=O)CC(C)C |
| InChI | InChI=1S/C9H16O2.C6H12O2.C2H6/c1-7(2)6-8(10)9-4-3-5-11-9;1-5(2)4-6(7)8-3;1-2/h7,9H,3-6H2,1-2H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | HBVXPBCHKAJEPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one?
The IUPAC name of ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one (CID 91001820) is ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one.
What is the SMILES notation for ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one?
The canonical SMILES for ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one is CC.CC(C)CC(=O)C1CCCO1.COC(=O)CC(C)C.
What is the InChIKey of ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one?
The InChIKey is HBVXPBCHKAJEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C6H12O2.C2H6/c1-7(2)6-8(10)9-4-3-5-11-9;1-5(2)4-6(7)8-3;1-2/h7,9H,3-6H2,1-2H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one?
ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one has a molecular weight of 302.46 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 3-methylbutanoate;3-methyl-1-(oxolan-2-yl)butan-1-one is sourced from PubChem (CID 91001820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).