About (5-propanoyloxolan-2-yl) acetate
(5-propanoyloxolan-2-yl) acetate (PubChem CID 11084564) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is (5-propanoyloxolan-2-yl) acetate.
Molecular Properties
| Compound Name | (5-propanoyloxolan-2-yl) acetate |
| PubChem CID | 11084564 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (5-propanoyloxolan-2-yl) acetate |
| SMILES | CCC(=O)C1CCC(OC(C)=O)O1 |
| InChI | InChI=1S/C9H14O4/c1-3-7(11)8-4-5-9(13-8)12-6(2)10/h8-9H,3-5H2,1-2H3 |
| InChIKey | KAEAXKLHVWWGTP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-propanoyloxolan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propanoyloxolan-2-yl) acetate?
The IUPAC name of (5-propanoyloxolan-2-yl) acetate (CID 11084564) is (5-propanoyloxolan-2-yl) acetate.
What is the SMILES notation for (5-propanoyloxolan-2-yl) acetate?
The canonical SMILES for (5-propanoyloxolan-2-yl) acetate is CCC(=O)C1CCC(OC(C)=O)O1.
What is the InChIKey of (5-propanoyloxolan-2-yl) acetate?
The InChIKey is KAEAXKLHVWWGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-3-7(11)8-4-5-9(13-8)12-6(2)10/h8-9H,3-5H2,1-2H3.
What are the key properties of (5-propanoyloxolan-2-yl) acetate?
(5-propanoyloxolan-2-yl) acetate has a molecular weight of 186.21 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propanoyloxolan-2-yl) acetate is sourced from PubChem (CID 11084564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).