C23H17NO4 — CID 15721861
3-(2-hydroxyphenyl)-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylic acid (PubChem CID 15721861) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylic acid.
| Compound Name | 3-(2-hydroxyphenyl)-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 15721861 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-(2-hydroxyphenyl)-2-(4-methylphenyl)-1-oxoisoquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(-n2c(-c3ccccc3O)c(C(=O)O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H17NO4/c1-14-10-12-15(13-11-14)24-21(18-8-4-5-9-19(18)25)20(23(27)28)16-6-2-3-7-17(16)22(24)26/h2-13,25H,1H3,(H,27,28) |
| InChIKey | UOERKNRQDJDEJR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |