C28H22N2O3 — CID 136716731
2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol (PubChem CID 136716731) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol.
| Compound Name | 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol |
|---|---|
| PubChem CID | 136716731 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol |
| SMILES | Cc1ccc(-n2c(-c3ccccc3O)nc(-c3ccccc3O)c2-c2ccccc2O)cc1 |
| InChI | InChI=1S/C28H22N2O3/c1-18-14-16-19(17-15-18)30-27(21-9-3-6-12-24(21)32)26(20-8-2-5-11-23(20)31)29-28(30)22-10-4-7-13-25(22)33/h2-17,31-33H,1H3 |
| InChIKey | NJUXJGOUYGYKJI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |