About 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol
2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol (PubChem CID 136716731) has the molecular formula C28H22N2O3
and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol.
Molecular Properties
| Compound Name | 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol |
| PubChem CID | 136716731 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol |
| SMILES | Cc1ccc(-n2c(-c3ccccc3O)nc(-c3ccccc3O)c2-c2ccccc2O)cc1 |
| InChI | InChI=1S/C28H22N2O3/c1-18-14-16-19(17-15-18)30-27(21-9-3-6-12-24(21)32)26(20-8-2-5-11-23(20)31)29-28(30)22-10-4-7-13-25(22)33/h2-17,31-33H,1H3 |
| InChIKey | NJUXJGOUYGYKJI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol?
The IUPAC name of 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol (CID 136716731) is 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol.
What is the SMILES notation for 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol?
The canonical SMILES for 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol is Cc1ccc(-n2c(-c3ccccc3O)nc(-c3ccccc3O)c2-c2ccccc2O)cc1.
What is the InChIKey of 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol?
The InChIKey is NJUXJGOUYGYKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22N2O3/c1-18-14-16-19(17-15-18)30-27(21-9-3-6-12-24(21)32)26(20-8-2-5-11-23(20)31)29-28(30)22-10-4-7-13-25(22)33/h2-17,31-33H,1H3.
What are the key properties of 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol?
2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol has a molecular weight of 434.50 g/mol, XLogP of 6.30, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,5-bis(2-hydroxyphenyl)-1-(4-methylphenyl)imidazol-4-yl]phenol is sourced from PubChem (CID 136716731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).