C21H29N3O5 — CID 157220918
ethyl 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylate (PubChem CID 157220918) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is ethyl 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 157220918 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | ethyl 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(CC(=O)c2cc([N+](=O)[O-])cn2CC(C)C)cn1CC(C)C |
| InChI | InChI=1S/C21H29N3O5/c1-6-29-21(26)19-7-16(12-22(19)10-14(2)3)8-20(25)18-9-17(24(27)28)13-23(18)11-15(4)5/h7,9,12-15H,6,8,10-11H2,1-5H3 |
| InChIKey | ASZCVOIIXMWEPI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|