C50H41ClN4O4 — CID 157221146
diphenylmethanimine;ethyl 7-(benzhydrylideneamino)quinoline-3-carboxylate;ethyl 7-chloroquinoline-3-carboxylate (PubChem CID 157221146) has the molecular formula C50H41ClN4O4 and a molecular weight of 797.36 g/mol. Its IUPAC name is diphenylmethanimine;ethyl 7-(benzhydrylideneamino)quinoline-3-carboxylate;ethyl 7-chloroquinoline-3-carboxylate.
| Compound Name | diphenylmethanimine;ethyl 7-(benzhydrylideneamino)quinoline-3-carboxylate;ethyl 7-chloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 157221146 |
| Molecular Formula | C50H41ClN4O4 |
| Molecular Weight | 797.36 g/mol |
| Exact Mass | 796.28 |
| IUPAC Name | diphenylmethanimine;ethyl 7-(benzhydrylideneamino)quinoline-3-carboxylate;ethyl 7-chloroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(Cl)ccc2c1.CCOC(=O)c1cnc2cc(N=C(c3ccccc3)c3ccccc3)ccc2c1.[H]N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2.C13H11N.C12H10ClNO2/c1-2-29-25(28)21-15-20-13-14-22(16-23(20)26-17-21)27-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-16-12(15)9-5-8-3-4-10(13)6-11(8)14-7-9/h3-17H,2H2,1H3;1-10,14H;3-7H,2H2,1H3 |
| InChIKey | ASZTYOYYPPWYJC-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.36 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|