About 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane
2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane (PubChem CID 157226539) has the molecular formula C30H38N2O
and a molecular weight of 442.65 g/mol. Its IUPAC name is 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane.
Molecular Properties
| Compound Name | 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane |
| PubChem CID | 157226539 |
| Molecular Formula | C30H38N2O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane |
| SMILES | C.C.CCC(C)c1ccc(-c2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C28H30N2O.2CH4/c1-6-19(2)20-7-9-21(10-8-20)22-11-13-23(14-12-22)26-29-30-27(31-26)24-15-17-25(18-16-24)28(3,4)5;;/h7-19H,6H2,1-5H3;2*1H4 |
| InChIKey | ATPHORAGKYMOTB-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane?
The IUPAC name of 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane (CID 157226539) is 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane.
What is the SMILES notation for 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane?
The canonical SMILES for 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane is C.C.CCC(C)c1ccc(-c2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)cc1.
What is the InChIKey of 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane?
The InChIKey is ATPHORAGKYMOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O.2CH4/c1-6-19(2)20-7-9-21(10-8-20)22-11-13-23(14-12-22)26-29-30-27(31-26)24-15-17-25(18-16-24)28(3,4)5;;/h7-19H,6H2,1-5H3;2*1H4.
What are the key properties of 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane?
2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane has a molecular weight of 442.65 g/mol, XLogP of 9.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-butan-2-ylphenyl)phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole;methane is sourced from PubChem (CID 157226539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).