About 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane
2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane (PubChem CID 157232645) has the molecular formula C21H43NS2
and a molecular weight of 373.72 g/mol. Its IUPAC name is 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane.
Molecular Properties
| Compound Name | 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane |
| PubChem CID | 157232645 |
| Molecular Formula | C21H43NS2 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane |
| SMILES | CC1CCC(C(CC2CCCCN2C)C2CCCCC2)CC1.S.S |
| InChI | InChI=1S/C21H39N.2H2S/c1-17-11-13-19(14-12-17)21(18-8-4-3-5-9-18)16-20-10-6-7-15-22(20)2;;/h17-21H,3-16H2,1-2H3;2*1H2 |
| InChIKey | AUGVCRQYQBWOJQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane?
The IUPAC name of 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane (CID 157232645) is 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane.
What is the SMILES notation for 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane?
The canonical SMILES for 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane is CC1CCC(C(CC2CCCCN2C)C2CCCCC2)CC1.S.S.
What is the InChIKey of 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane?
The InChIKey is AUGVCRQYQBWOJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39N.2H2S/c1-17-11-13-19(14-12-17)21(18-8-4-3-5-9-18)16-20-10-6-7-15-22(20)2;;/h17-21H,3-16H2,1-2H3;2*1H2.
What are the key properties of 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane?
2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane has a molecular weight of 373.72 g/mol, XLogP of 6.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-cyclohexyl-2-(4-methylcyclohexyl)ethyl]-1-methylpiperidine;sulfane is sourced from PubChem (CID 157232645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).