C25H43NO4 — CID 50990468
(E)-but-2-enedioic acid;2-(2,2-dicyclohexylethyl)-1-ethylpiperidine (PubChem CID 50990468) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(2,2-dicyclohexylethyl)-1-ethylpiperidine.
| Compound Name | (E)-but-2-enedioic acid;2-(2,2-dicyclohexylethyl)-1-ethylpiperidine |
|---|---|
| PubChem CID | 50990468 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(2,2-dicyclohexylethyl)-1-ethylpiperidine |
| SMILES | CCN1CCCCC1CC(C1CCCCC1)C1CCCCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H39N.C4H4O4/c1-2-22-16-10-9-15-20(22)17-21(18-11-5-3-6-12-18)19-13-7-4-8-14-19;5-3(6)1-2-4(7)8/h18-21H,2-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OPPBNXXGPKDMPH-WLHGVMLRSA-N |
| XLogP | 5.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|