About 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile
4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile (PubChem CID 157237924) has the molecular formula C18H22N10
and a molecular weight of 378.44 g/mol. Its IUPAC name is 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile |
| PubChem CID | 157237924 |
| Molecular Formula | C18H22N10 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile |
| SMILES | CCCCn1nc(C#N)c(N)c1N.N#Cc1nn(-c2ccccc2)c(N)c1N |
| InChI | InChI=1S/C10H9N5.C8H13N5/c11-6-8-9(12)10(13)15(14-8)7-4-2-1-3-5-7;1-2-3-4-13-8(11)7(10)6(5-9)12-13/h1-5H,12-13H2;2-4,10-11H2,1H3 |
| InChIKey | AUVZWOHXZSECGK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 187.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile?
The IUPAC name of 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile (CID 157237924) is 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile.
What is the SMILES notation for 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile?
The canonical SMILES for 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile is CCCCn1nc(C#N)c(N)c1N.N#Cc1nn(-c2ccccc2)c(N)c1N.
What is the InChIKey of 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile?
The InChIKey is AUVZWOHXZSECGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5.C8H13N5/c11-6-8-9(12)10(13)15(14-8)7-4-2-1-3-5-7;1-2-3-4-13-8(11)7(10)6(5-9)12-13/h1-5H,12-13H2;2-4,10-11H2,1H3.
What are the key properties of 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile?
4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile has a molecular weight of 378.44 g/mol, XLogP of 1.63, 4 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-1-butylpyrazole-3-carbonitrile;4,5-diamino-1-phenylpyrazole-3-carbonitrile is sourced from PubChem (CID 157237924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).