C23H24N4O6 — CID 157244263
ethyl 2,4-dioxo-4-pyridin-3-ylbutanoate;ethyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate (PubChem CID 157244263) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl 2,4-dioxo-4-pyridin-3-ylbutanoate;ethyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate.
| Compound Name | ethyl 2,4-dioxo-4-pyridin-3-ylbutanoate;ethyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 157244263 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | ethyl 2,4-dioxo-4-pyridin-3-ylbutanoate;ethyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1cccnc1.CCOC(=O)c1cc(-c2cccnc2)nn1C |
| InChI | InChI=1S/C12H13N3O2.C11H11NO4/c1-3-17-12(16)11-7-10(14-15(11)2)9-5-4-6-13-8-9;1-2-16-11(15)10(14)6-9(13)8-4-3-5-12-7-8/h4-8H,3H2,1-2H3;3-5,7H,2,6H2,1H3 |
| InChIKey | AVOLZWOIECFYAV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 130.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|