C25H36N4O2 — CID 15724479
1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azocan-2-one (PubChem CID 15724479) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azocan-2-one.
| Compound Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azocan-2-one |
|---|---|
| PubChem CID | 15724479 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azocan-2-one |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(CN3CCCCCCC3=O)n2C)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-26-21(12-13-22(26)20-29-14-8-4-3-5-11-25(29)30)19-27-15-17-28(18-16-27)23-9-6-7-10-24(23)31-2/h6-7,9-10,12-13H,3-5,8,11,14-20H2,1-2H3 |
| InChIKey | IXXYHUVMEBTGED-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |