C27H33N3O4 — CID 18738366
1-(2-oxoazepan-1-yl)-5-[4-(2-phenoxyphenyl)piperazin-1-yl]pentane-2,4-dione (PubChem CID 18738366) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-(2-oxoazepan-1-yl)-5-[4-(2-phenoxyphenyl)piperazin-1-yl]pentane-2,4-dione.
| Compound Name | 1-(2-oxoazepan-1-yl)-5-[4-(2-phenoxyphenyl)piperazin-1-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 18738366 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 1-(2-oxoazepan-1-yl)-5-[4-(2-phenoxyphenyl)piperazin-1-yl]pentane-2,4-dione |
| SMILES | O=C(CC(=O)CN1CCCCCC1=O)CN1CCN(c2ccccc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C27H33N3O4/c31-22(19-23(32)21-30-14-8-2-5-13-27(30)33)20-28-15-17-29(18-16-28)25-11-6-7-12-26(25)34-24-9-3-1-4-10-24/h1,3-4,6-7,9-12H,2,5,8,13-21H2 |
| InChIKey | AOVBGMGJGMOZLT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|