C22H36N4O7S — CID 70162263
2-(2-oxopiperidin-1-yl)-N-[2-[4-(2-propoxyphenyl)piperazin-1-yl]ethyl]acetamide;sulfuric acid (PubChem CID 70162263) has the molecular formula C22H36N4O7S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-N-[2-[4-(2-propoxyphenyl)piperazin-1-yl]ethyl]acetamide;sulfuric acid.
| Compound Name | 2-(2-oxopiperidin-1-yl)-N-[2-[4-(2-propoxyphenyl)piperazin-1-yl]ethyl]acetamide;sulfuric acid |
|---|---|
| PubChem CID | 70162263 |
| Molecular Formula | C22H36N4O7S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-N-[2-[4-(2-propoxyphenyl)piperazin-1-yl]ethyl]acetamide;sulfuric acid |
| SMILES | CCCOc1ccccc1N1CCN(CCNC(=O)CN2CCCCC2=O)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C22H34N4O3.H2O4S/c1-2-17-29-20-8-4-3-7-19(20)25-15-13-24(14-16-25)12-10-23-21(27)18-26-11-6-5-9-22(26)28;1-5(2,3)4/h3-4,7-8H,2,5-6,9-18H2,1H3,(H,23,27);(H2,1,2,3,4) |
| InChIKey | HDHUBUNBEDACOD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|