C24H34N4O6 — CID 91281800
N-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]ethyl]-2-(1,3,5,6-tetrahydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetamide (PubChem CID 91281800) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]ethyl]-2-(1,3,5,6-tetrahydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetamide.
| Compound Name | N-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]ethyl]-2-(1,3,5,6-tetrahydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 91281800 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[2-[4-(2-ethoxyphenyl)piperazin-1-yl]ethyl]-2-(1,3,5,6-tetrahydroxy-4,5,6,7-tetrahydroisoindol-2-yl)acetamide |
| SMILES | CCOc1ccccc1N1CCN(CCNC(=O)Cn2c(O)c3c(c2O)CC(O)C(O)C3)CC1 |
| InChI | InChI=1S/C24H34N4O6/c1-2-34-21-6-4-3-5-18(21)27-11-9-26(10-12-27)8-7-25-22(31)15-28-23(32)16-13-19(29)20(30)14-17(16)24(28)33/h3-6,19-20,29-30,32-33H,2,7-15H2,1H3,(H,25,31) |
| InChIKey | JUNNKWBGJOVSOR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |