C27H27BrF4N2O2S — CID 157246755
tert-butyl (2S)-2-[4-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;sulfane (PubChem CID 157246755) has the molecular formula C27H27BrF4N2O2S and a molecular weight of 599.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;sulfane.
| Compound Name | tert-butyl (2S)-2-[4-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 157246755 |
| Molecular Formula | C27H27BrF4N2O2S |
| Molecular Weight | 599.49 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | tert-butyl (2S)-2-[4-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate;sulfane |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc3c(c2)C(F)(F)C(F)(F)c2cc(Br)ccc2-3)C1.S |
| InChI | InChI=1S/C27H25BrF4N2O2.H2S/c1-25(2,3)36-24(35)34-10-4-5-23(34)22-12-16(14-33-22)15-6-8-18-19-9-7-17(28)13-21(19)27(31,32)26(29,30)20(18)11-15;/h6-9,11,13-14,23H,4-5,10,12H2,1-3H3;1H2/t23-;/m0./s1 |
| InChIKey | AVWDOXZRSNADBX-BQAIUKQQSA-N |
| XLogP | 8.01 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.49 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|